Reaction of C6H5-C(OH)CH3-C(OH)CH3-C6H5 with Conc H2SO4
Explanation:

1. Formation of Carbocation:
- The reaction of C6H5-C(OH)CH3-C(OH)CH3-C6H5 with conc H2SO4 involves protonation of the alcohol groups by the strong acid.
- This leads to the formation of carbocation intermediates.

2. Rearrangement:
- The carbocation intermediates undergo rearrangement to form more stable carbocations through hydride or alkyl shifts.

3. Electrophilic Aromatic Substitution:
- The more stable carbocations then undergo electrophilic aromatic substitution reactions with the aromatic rings in the molecule.
- This results in the formation of substituted aromatic compounds.

4. Formation of Aromatic Sulfonic Acids:
- The reaction with conc H2SO4 can also lead to the formation of aromatic sulfonic acids by sulfonation of the aromatic rings.

5. Overall Reaction:
- The overall reaction involves the protonation of the alcohol groups, rearrangement of carbocation intermediates, electrophilic aromatic substitution, and formation of aromatic sulfonic acids.
This reaction is important in organic chemistry as it demonstrates the reactivity of aromatic compounds towards strong acids and their ability to undergo various substitution reactions.