Number of iso groups in 3-ethyl-4-isopropyl-2-methylheptane

To determine the number of iso groups in 3-ethyl-4-isopropyl-2-methylheptane, we need to understand the structure and nomenclature of the compound.

Structure of 3-ethyl-4-isopropyl-2-methylheptane

The compound 3-ethyl-4-isopropyl-2-methylheptane can be represented as follows:

CH3-CH2-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3

Nomenclature of the compound

The compound name can be broken down as follows:

- The prefix "3-ethyl" indicates that there is an ethyl group (C2H5) attached to the third carbon atom of the parent chain.
- The prefix "4-isopropyl" indicates that there is an isopropyl group (CH(CH3)2) attached to the fourth carbon atom of the parent chain.
- The prefix "2-methyl" indicates that there is a methyl group (CH3) attached to the second carbon atom of the parent chain.
- The parent chain is a heptane, which means it has 7 carbon atoms in a linear arrangement.

Determining the number of iso groups

An iso group refers to an isopropyl group (CH(CH3)2), which consists of three carbon atoms arranged in a specific manner. In the compound 3-ethyl-4-isopropyl-2-methylheptane, there is one isopropyl group present.

Therefore, the number of iso groups in 3-ethyl-4-isopropyl-2-methylheptane is 1.