NEET Exam > NEET Questions > Iii) Draw structures of the following compoun...
Start Learning for Free
Iii) Draw structures of the following compounds 1. butandial
2. 2 methy-1, 3 butandiol
3. 3-methyl-1-butene
4. Cyclohexane carbaldehyde
5. 3-chloro cyclopentanol
6. 1-penten-3-yne
7. 2'-bromo ethyl-1, 3-hydroxy pentanoate
8. trans butane dioic acid
9. 2-propenoic acid
10. 2,2-dimethyl-1,3-propandiol
11. 3-methyl-2-pentenoic acid
12. 4-hydroxy-2-pentanone
13. 4,4-dimethyl cyclopentene
14. propene nitrile
15. Cyclohexane carbaldehyde
16.4-methyl-2-hexyne?
2. 2 methy-1, 3 butandiol
3. 3-methyl-1-butene
4. Cyclohexane carbaldehyde
5. 3-chloro cyclopentanol
6. 1-penten-3-yne
7. 2'-bromo ethyl-1, 3-hydroxy pentanoate
8. trans butane dioic acid
9. 2-propenoic acid
10. 2,2-dimethyl-1,3-propandiol
11. 3-methyl-2-pentenoic acid
12. 4-hydroxy-2-pentanone
13. 4,4-dimethyl cyclopentene
14. propene nitrile
15. Cyclohexane carbaldehyde
16.4-methyl-2-hexyne?
Most Upvoted Answer
Iii) Draw structures of the following compounds 1. butandial 2. 2 meth...
1. Butanodial:
Butanodial is an aldehyde with the molecular formula C4H8O. It is a four-carbon compound with an aldehyde group (-CHO) attached to one end of the carbon chain. The structure of butanodial can be represented as follows:
CH3-CH2-CH2-CHO
2. 2-Methyl-1,3-butanediol:
2-Methyl-1,3-butanediol is a diol with the molecular formula C5H12O2. It contains two hydroxyl groups (-OH) attached to a five-carbon chain, with a methyl group (-CH3) attached to the second carbon atom. The structure of 2-methyl-1,3-butanediol can be represented as follows:
CH3-CH(CH3)-CH(OH)-CH2-OH
3. 3-Methyl-1-butene:
3-Methyl-1-butene is an alkene with the molecular formula C5H10. It contains a double bond between the first and second carbon atoms, with a methyl group (-CH3) attached to the third carbon atom. The structure of 3-methyl-1-butene can be represented as follows:
CH3-CH=C(CH3)-CH2-CH3
4. Cyclohexane carbaldehyde:
Cyclohexane carbaldehyde is an aldehyde with the molecular formula C7H12O. It is an aldehyde group (-CHO) attached to one of the carbon atoms in a cyclohexane ring. The structure of cyclohexane carbaldehyde can be represented as follows:
CH2=CH-CH2-CH2-CH2-CH2-CHO
5. 3-Chlorocyclopentanol:
3-Chlorocyclopentanol is an alcohol with the molecular formula C5H9ClO. It contains a chlorine atom (-Cl) attached to the third carbon atom in a cyclopentane ring, with a hydroxyl group (-OH) attached to the same carbon atom. The structure of 3-chlorocyclopentanol can be represented as follows:
CH2-CH2-CH(Cl)-CH2-OH
6. 1-Penten-3-yne:
1-Penten-3-yne is an alkyne with the molecular formula C5H8. It contains a triple bond between the first and second carbon atoms, with a double bond between the third and fourth carbon atoms. The structure of 1-penten-3-yne can be represented as follows:
CH3-CH=CH-C≡CH
7. 2'-Bromoethyl-1,3-hydroxypentanoate:
2'-Bromoethyl-1,3-hydroxypentanoate is an ester with the molecular formula C8H15BrO3. It contains a bromoethyl group (-CH2
Butanodial is an aldehyde with the molecular formula C4H8O. It is a four-carbon compound with an aldehyde group (-CHO) attached to one end of the carbon chain. The structure of butanodial can be represented as follows:
CH3-CH2-CH2-CHO
2. 2-Methyl-1,3-butanediol:
2-Methyl-1,3-butanediol is a diol with the molecular formula C5H12O2. It contains two hydroxyl groups (-OH) attached to a five-carbon chain, with a methyl group (-CH3) attached to the second carbon atom. The structure of 2-methyl-1,3-butanediol can be represented as follows:
CH3-CH(CH3)-CH(OH)-CH2-OH
3. 3-Methyl-1-butene:
3-Methyl-1-butene is an alkene with the molecular formula C5H10. It contains a double bond between the first and second carbon atoms, with a methyl group (-CH3) attached to the third carbon atom. The structure of 3-methyl-1-butene can be represented as follows:
CH3-CH=C(CH3)-CH2-CH3
4. Cyclohexane carbaldehyde:
Cyclohexane carbaldehyde is an aldehyde with the molecular formula C7H12O. It is an aldehyde group (-CHO) attached to one of the carbon atoms in a cyclohexane ring. The structure of cyclohexane carbaldehyde can be represented as follows:
CH2=CH-CH2-CH2-CH2-CH2-CHO
5. 3-Chlorocyclopentanol:
3-Chlorocyclopentanol is an alcohol with the molecular formula C5H9ClO. It contains a chlorine atom (-Cl) attached to the third carbon atom in a cyclopentane ring, with a hydroxyl group (-OH) attached to the same carbon atom. The structure of 3-chlorocyclopentanol can be represented as follows:
CH2-CH2-CH(Cl)-CH2-OH
6. 1-Penten-3-yne:
1-Penten-3-yne is an alkyne with the molecular formula C5H8. It contains a triple bond between the first and second carbon atoms, with a double bond between the third and fourth carbon atoms. The structure of 1-penten-3-yne can be represented as follows:
CH3-CH=CH-C≡CH
7. 2'-Bromoethyl-1,3-hydroxypentanoate:
2'-Bromoethyl-1,3-hydroxypentanoate is an ester with the molecular formula C8H15BrO3. It contains a bromoethyl group (-CH2
Attention NEET Students!
To make sure you are not studying endlessly, EduRev has designed NEET study material, with Structured Courses, Videos, & Test Series. Plus get personalized analysis, doubt solving and improvement plans to achieve a great score in NEET.
|
Explore Courses for NEET exam
|
|
Similar NEET Doubts
Top Courses for NEETView all
Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne?
Question Description
Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? for NEET 2024 is part of NEET preparation. The Question and answers have been prepared according to the NEET exam syllabus. Information about Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? covers all topics & solutions for NEET 2024 Exam. Find important definitions, questions, meanings, examples, exercises and tests below for Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne?.
Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? for NEET 2024 is part of NEET preparation. The Question and answers have been prepared according to the NEET exam syllabus. Information about Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? covers all topics & solutions for NEET 2024 Exam. Find important definitions, questions, meanings, examples, exercises and tests below for Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne?.
Solutions for Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? in English & in Hindi are available as part of our courses for NEET.
Download more important topics, notes, lectures and mock test series for NEET Exam by signing up for free.
Here you can find the meaning of Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? defined & explained in the simplest way possible. Besides giving the explanation of
Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne?, a detailed solution for Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? has been provided alongside types of Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? theory, EduRev gives you an
ample number of questions to practice Iii) Draw structures of the following compounds 1. butandial 2. 2 methy-1, 3 butandiol3. 3-methyl-1-butene 4. Cyclohexane carbaldehyde5. 3-chloro cyclopentanol6. 1-penten-3-yne 7. 2'-bromo ethyl-1, 3-hydroxy pentanoate 8. trans butane dioic acid 9. 2-propenoic acid 10. 2,2-dimethyl-1,3-propandiol 11. 3-methyl-2-pentenoic acid 12. 4-hydroxy-2-pentanone13. 4,4-dimethyl cyclopentene14. propene nitrile 15. Cyclohexane carbaldehyde 16.4-methyl-2-hexyne? tests, examples and also practice NEET tests.
|
|
Explore Courses for NEET exam
|
|
Suggested Free Tests
Signup for Free!
Signup to see your scores go up within 7 days! Learn & Practice with 1000+ FREE Notes, Videos & Tests.
|
© EduRev
|
Education Revolution
|
Follow Us
|
Signup to see your scores
go up within 7 days!
Access 1000+ FREE Docs, Videos and Tests
Takes less than 10 seconds to signup